C38H29FNO+ — CID 164849243
2-[7-fluoro-3-methyl-6-[4-(2-methylphenyl)phenyl]dibenzofuran-4-yl]-1-methyl-5-phenylpyridin-1-ium (PubChem CID 164849243) has the molecular formula C38H29FNO+ and a molecular weight of 534.65 g/mol. Its IUPAC name is 2-[7-fluoro-3-methyl-6-[4-(2-methylphenyl)phenyl]dibenzofuran-4-yl]-1-methyl-5-phenylpyridin-1-ium.
| Compound Name | 2-[7-fluoro-3-methyl-6-[4-(2-methylphenyl)phenyl]dibenzofuran-4-yl]-1-methyl-5-phenylpyridin-1-ium |
|---|---|
| PubChem CID | 164849243 |
| Molecular Formula | C38H29FNO+ |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 2-[7-fluoro-3-methyl-6-[4-(2-methylphenyl)phenyl]dibenzofuran-4-yl]-1-methyl-5-phenylpyridin-1-ium |
| SMILES | Cc1ccccc1-c1ccc(-c2c(F)ccc3c2oc2c(-c4ccc(-c5ccccc5)c[n+]4C)c(C)ccc23)cc1 |
| InChI | InChI=1S/C38H29FNO/c1-24-9-7-8-12-30(24)27-14-16-28(17-15-27)36-33(39)21-20-32-31-19-13-25(2)35(37(31)41-38(32)36)34-22-18-29(23-40(34)3)26-10-5-4-6-11-26/h4-23H,1-3H3/q+1 |
| InChIKey | OHPBZDYAOAGORP-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|