C31H22F2NO+ — CID 169282686
2,3,5-trideuterio-4-fluoro-6-[7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 169282686) has the molecular formula C31H22F2NO+ and a molecular weight of 465.54 g/mol. Its IUPAC name is 2,3,5-trideuterio-4-fluoro-6-[7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2,3,5-trideuterio-4-fluoro-6-[7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 169282686 |
| Molecular Formula | C31H22F2NO+ |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 2,3,5-trideuterio-4-fluoro-6-[7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]c1c(F)c([2H])c(-c2c(C)ccc3c2oc2c(-c4ccc(-c5ccccc5)cc4)c(F)ccc23)[n+](C)c1[2H] |
| InChI | InChI=1S/C31H22F2NO/c1-19-8-13-24-25-14-15-26(33)29(22-11-9-21(10-12-22)20-6-4-3-5-7-20)31(25)35-30(24)28(19)27-18-23(32)16-17-34(27)2/h3-18H,1-2H3/q+1/i16D,17D,18D |
| InChIKey | QOMBXYXJNDFZDF-LDKTXMCTSA-N |
| XLogP | 8.00 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|