C24H23FN3O+ — CID 171407204
5-tert-butyl-8-(4-fluoro-1,5-dimethylpyridin-1-ium-2-yl)-2-isocyano-7-methyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 171407204) has the molecular formula C24H23FN3O+ and a molecular weight of 388.47 g/mol. Its IUPAC name is 5-tert-butyl-8-(4-fluoro-1,5-dimethylpyridin-1-ium-2-yl)-2-isocyano-7-methyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 5-tert-butyl-8-(4-fluoro-1,5-dimethylpyridin-1-ium-2-yl)-2-isocyano-7-methyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 171407204 |
| Molecular Formula | C24H23FN3O+ |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 5-tert-butyl-8-(4-fluoro-1,5-dimethylpyridin-1-ium-2-yl)-2-isocyano-7-methyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | [C-]#[N+]c1ccc2c(n1)oc1c(-c3cc(F)c(C)c[n+]3C)c(C)cc(C(C)(C)C)c12 |
| InChI | InChI=1S/C24H23FN3O/c1-13-10-16(24(3,4)5)21-15-8-9-19(26-6)27-23(15)29-22(21)20(13)18-11-17(25)14(2)12-28(18)7/h8-12H,1-5,7H3/q+1 |
| InChIKey | ISFLBNHZGOBDLK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 34.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|