C25H19F2N2O+ — CID 153464396
2,5-difluoro-7-methyl-8-[1-methyl-5-(2-methylphenyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 153464396) has the molecular formula C25H19F2N2O+ and a molecular weight of 401.44 g/mol. Its IUPAC name is 2,5-difluoro-7-methyl-8-[1-methyl-5-(2-methylphenyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2,5-difluoro-7-methyl-8-[1-methyl-5-(2-methylphenyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 153464396 |
| Molecular Formula | C25H19F2N2O+ |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 2,5-difluoro-7-methyl-8-[1-methyl-5-(2-methylphenyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccccc1-c1ccc(-c2c(C)cc(F)c3c2oc2nc(F)ccc23)[n+](C)c1 |
| InChI | InChI=1S/C25H19F2N2O/c1-14-6-4-5-7-17(14)16-8-10-20(29(3)13-16)22-15(2)12-19(26)23-18-9-11-21(27)28-25(18)30-24(22)23/h4-13H,1-3H3/q+1 |
| InChIKey | PCNGRKYYRVJQLK-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|