C20H15FN3S+ — CID 164778792
8-[4-fluoro-1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-2-isocyano-7-methyl-[1]benzothiolo[2,3-b]pyridine (PubChem CID 164778792) has the molecular formula C20H15FN3S+ and a molecular weight of 351.44 g/mol. Its IUPAC name is 8-[4-fluoro-1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-2-isocyano-7-methyl-[1]benzothiolo[2,3-b]pyridine.
| Compound Name | 8-[4-fluoro-1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-2-isocyano-7-methyl-[1]benzothiolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 164778792 |
| Molecular Formula | C20H15FN3S+ |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 8-[4-fluoro-1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-2-isocyano-7-methyl-[1]benzothiolo[2,3-b]pyridine |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2c(C)ccc3c2sc2nc([N+]#[C-])ccc23)cc1F |
| InChI | InChI=1S/C20H15FN3S/c1-11-5-6-13-14-7-8-17(22-3)23-20(14)25-19(13)18(11)16-9-15(21)12(2)10-24(16)4/h5-10H,1-2,4H3/q+1/i2D3 |
| InChIKey | YOVFAMJZMXKBRN-BMSJAHLVSA-N |
| XLogP | 5.25 |
| TPSA | 21.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|