C21H16FN2Se+ — CID 164778755
4-fluoro-2-(8-isocyano-3-methyldibenzoselenophen-4-yl)-1-methyl-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 164778755) has the molecular formula C21H16FN2Se+ and a molecular weight of 397.35 g/mol. Its IUPAC name is 4-fluoro-2-(8-isocyano-3-methyldibenzoselenophen-4-yl)-1-methyl-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 4-fluoro-2-(8-isocyano-3-methyldibenzoselenophen-4-yl)-1-methyl-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 164778755 |
| Molecular Formula | C21H16FN2Se+ |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 4-fluoro-2-(8-isocyano-3-methyldibenzoselenophen-4-yl)-1-methyl-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2c(C)ccc3c2[se]c2ccc([N+]#[C-])cc23)cc1F |
| InChI | InChI=1S/C21H16FN2Se/c1-12-5-7-15-16-9-14(23-3)6-8-19(16)25-21(15)20(12)18-10-17(22)13(2)11-24(18)4/h5-11H,1-2,4H3/q+1/i2D3 |
| InChIKey | CSWHLJLUUODDLY-BMSJAHLVSA-N |
| XLogP | 4.85 |
| TPSA | 8.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|