C22H19N2O+ — CID 154615347
2-(8-isocyano-2-methyldibenzofuran-1-yl)-1,4,5-trimethylpyridin-1-ium (PubChem CID 154615347) has the molecular formula C22H19N2O+ and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-(8-isocyano-2-methyldibenzofuran-1-yl)-1,4,5-trimethylpyridin-1-ium.
| Compound Name | 2-(8-isocyano-2-methyldibenzofuran-1-yl)-1,4,5-trimethylpyridin-1-ium |
|---|---|
| PubChem CID | 154615347 |
| Molecular Formula | C22H19N2O+ |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-(8-isocyano-2-methyldibenzofuran-1-yl)-1,4,5-trimethylpyridin-1-ium |
| SMILES | [C-]#[N+]c1ccc2oc3ccc(C)c(-c4cc(C)c(C)c[n+]4C)c3c2c1 |
| InChI | InChI=1S/C22H19N2O/c1-13-6-8-20-22(17-11-16(23-4)7-9-19(17)25-20)21(13)18-10-14(2)15(3)12-24(18)5/h6-12H,1-3,5H3/q+1 |
| InChIKey | CAUCUXBTYXWWCI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|