C21H17N2O+ — CID 164777966
2,3,5-trideuterio-6-(8-isocyano-3-methyldibenzofuran-4-yl)-1-methyl-4-(trideuteriomethyl)pyridin-1-ium (PubChem CID 164777966) has the molecular formula C21H17N2O+ and a molecular weight of 319.42 g/mol. Its IUPAC name is 2,3,5-trideuterio-6-(8-isocyano-3-methyldibenzofuran-4-yl)-1-methyl-4-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 2,3,5-trideuterio-6-(8-isocyano-3-methyldibenzofuran-4-yl)-1-methyl-4-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 164777966 |
| Molecular Formula | C21H17N2O+ |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 2,3,5-trideuterio-6-(8-isocyano-3-methyldibenzofuran-4-yl)-1-methyl-4-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]c1c(C([2H])([2H])[2H])c([2H])c(-c2c(C)ccc3c2oc2ccc([N+]#[C-])cc23)[n+](C)c1[2H] |
| InChI | InChI=1S/C21H17N2O/c1-13-9-10-23(4)18(11-13)20-14(2)5-7-16-17-12-15(22-3)6-8-19(17)24-21(16)20/h5-12H,1-2,4H3/q+1/i1D3,9D,10D,11D |
| InChIKey | KJXFSSMDQMBHBD-MLSGYINUSA-N |
| XLogP | 5.25 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|