C25H25N2O+ — CID 163806644
2-(7-isocyano-3,9-dimethyldibenzofuran-4-yl)-1,6-dimethyl-4-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium (PubChem CID 163806644) has the molecular formula C25H25N2O+ and a molecular weight of 373.51 g/mol. Its IUPAC name is 2-(7-isocyano-3,9-dimethyldibenzofuran-4-yl)-1,6-dimethyl-4-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium.
| Compound Name | 2-(7-isocyano-3,9-dimethyldibenzofuran-4-yl)-1,6-dimethyl-4-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 163806644 |
| Molecular Formula | C25H25N2O+ |
| Molecular Weight | 373.51 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 2-(7-isocyano-3,9-dimethyldibenzofuran-4-yl)-1,6-dimethyl-4-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])C([2H])(C)c1cc(C)[n+](C)c(-c2c(C)ccc3c2oc2cc([N+]#[C-])cc(C)c23)c1 |
| InChI | InChI=1S/C25H25N2O/c1-14(2)18-11-17(5)27(7)21(12-18)24-15(3)8-9-20-23-16(4)10-19(26-6)13-22(23)28-25(20)24/h8-14H,1-5,7H3/q+1/i1D3,14D |
| InChIKey | JIXIHVLQFRXTJE-CZEVESCESA-N |
| XLogP | 6.68 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.51 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|