C31H28FN2O+ — CID 164778687
4-(1,1-dideuterio-2,2-dimethylpropyl)-5-fluoro-2-(7-isocyano-3-methyl-1-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium (PubChem CID 164778687) has the molecular formula C31H28FN2O+ and a molecular weight of 465.59 g/mol. Its IUPAC name is 4-(1,1-dideuterio-2,2-dimethylpropyl)-5-fluoro-2-(7-isocyano-3-methyl-1-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 4-(1,1-dideuterio-2,2-dimethylpropyl)-5-fluoro-2-(7-isocyano-3-methyl-1-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 164778687 |
| Molecular Formula | C31H28FN2O+ |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 4-(1,1-dideuterio-2,2-dimethylpropyl)-5-fluoro-2-(7-isocyano-3-methyl-1-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
| SMILES | [2H]C([2H])(c1cc(-c2c(C)cc(-c3ccccc3)c3c2oc2cc([N+]#[C-])ccc23)[n+](C)cc1F)C(C)(C)C |
| InChI | InChI=1S/C31H28FN2O/c1-19-14-24(20-10-8-7-9-11-20)29-23-13-12-22(33-5)16-27(23)35-30(29)28(19)26-15-21(17-31(2,3)4)25(32)18-34(26)6/h7-16,18H,17H2,1-4,6H3/q+1/i17D2 |
| InChIKey | GVGUERVCOJUXSQ-FBCWWBABSA-N |
| XLogP | 8.33 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|