C32H35N2OSi+ — CID 164808010
[2-(7-isocyano-2,3-dimethyldibenzofuran-4-yl)-1-methyl-4-(2-methylpropyl)quinolin-1-ium-6-yl]-trimethylsilane (PubChem CID 164808010) has the molecular formula C32H35N2OSi+ and a molecular weight of 491.73 g/mol. Its IUPAC name is [2-(7-isocyano-2,3-dimethyldibenzofuran-4-yl)-1-methyl-4-(2-methylpropyl)quinolin-1-ium-6-yl]-trimethylsilane.
| Compound Name | [2-(7-isocyano-2,3-dimethyldibenzofuran-4-yl)-1-methyl-4-(2-methylpropyl)quinolin-1-ium-6-yl]-trimethylsilane |
|---|---|
| PubChem CID | 164808010 |
| Molecular Formula | C32H35N2OSi+ |
| Molecular Weight | 491.73 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | [2-(7-isocyano-2,3-dimethyldibenzofuran-4-yl)-1-methyl-4-(2-methylpropyl)quinolin-1-ium-6-yl]-trimethylsilane |
| SMILES | [C-]#[N+]c1ccc2c(c1)oc1c(-c3cc(CC(C)C)c4cc([Si](C)(C)C)ccc4[n+]3C)c(C)c(C)cc12 |
| InChI | InChI=1S/C32H35N2OSi/c1-19(2)14-22-16-29(34(6)28-13-11-24(18-26(22)28)36(7,8)9)31-21(4)20(3)15-27-25-12-10-23(33-5)17-30(25)35-32(27)31/h10-13,15-19H,14H2,1-4,6-9H3/q+1 |
| InChIKey | YJBKODKBADLLJP-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.73 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|