C34H39FNOSi+ — CID 164808080
[4-(cyclopentylmethyl)-2-(7-fluoro-2,3,6-trimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-6-yl]-trimethylsilane (PubChem CID 164808080) has the molecular formula C34H39FNOSi+ and a molecular weight of 524.78 g/mol. Its IUPAC name is [4-(cyclopentylmethyl)-2-(7-fluoro-2,3,6-trimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-6-yl]-trimethylsilane.
| Compound Name | [4-(cyclopentylmethyl)-2-(7-fluoro-2,3,6-trimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-6-yl]-trimethylsilane |
|---|---|
| PubChem CID | 164808080 |
| Molecular Formula | C34H39FNOSi+ |
| Molecular Weight | 524.78 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | [4-(cyclopentylmethyl)-2-(7-fluoro-2,3,6-trimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-6-yl]-trimethylsilane |
| SMILES | Cc1cc2c(oc3c(C)c(F)ccc32)c(-c2cc(CC3CCCC3)c3cc([Si](C)(C)C)ccc3[n+]2C)c1C |
| InChI | InChI=1S/C34H39FNOSi/c1-20-16-28-26-13-14-29(35)22(3)33(26)37-34(28)32(21(20)2)31-18-24(17-23-10-8-9-11-23)27-19-25(38(5,6)7)12-15-30(27)36(31)4/h12-16,18-19,23H,8-11,17H2,1-7H3/q+1 |
| InChIKey | ZNKFWHKWIWWOGA-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.78 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|