C29H29FNO+ — CID 163866810
2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1,7-dimethyl-4-(2-methylpropyl)quinolin-1-ium (PubChem CID 163866810) has the molecular formula C29H29FNO+ and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1,7-dimethyl-4-(2-methylpropyl)quinolin-1-ium.
| Compound Name | 2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1,7-dimethyl-4-(2-methylpropyl)quinolin-1-ium |
|---|---|
| PubChem CID | 163866810 |
| Molecular Formula | C29H29FNO+ |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1,7-dimethyl-4-(2-methylpropyl)quinolin-1-ium |
| SMILES | Cc1ccc2c(CC(C)C)cc(-c3c(C)c(C)cc4c3oc3cc(F)ccc34)[n+](C)c2c1 |
| InChI | InChI=1S/C29H29FNO/c1-16(2)11-20-14-26(31(6)25-12-17(3)7-9-22(20)25)28-19(5)18(4)13-24-23-10-8-21(30)15-27(23)32-29(24)28/h7-10,12-16H,11H2,1-6H3/q+1 |
| InChIKey | JRMREPJYOLAZLS-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|