C28H30NOSi+ — CID 163479043
[1,7-dimethyl-2-[3-methyl-2-(trideuteriomethyl)dibenzofuran-4-yl]quinolin-1-ium-6-yl]-trimethylsilane (PubChem CID 163479043) has the molecular formula C28H30NOSi+ and a molecular weight of 427.66 g/mol. Its IUPAC name is [1,7-dimethyl-2-[3-methyl-2-(trideuteriomethyl)dibenzofuran-4-yl]quinolin-1-ium-6-yl]-trimethylsilane.
| Compound Name | [1,7-dimethyl-2-[3-methyl-2-(trideuteriomethyl)dibenzofuran-4-yl]quinolin-1-ium-6-yl]-trimethylsilane |
|---|---|
| PubChem CID | 163479043 |
| Molecular Formula | C28H30NOSi+ |
| Molecular Weight | 427.66 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | [1,7-dimethyl-2-[3-methyl-2-(trideuteriomethyl)dibenzofuran-4-yl]quinolin-1-ium-6-yl]-trimethylsilane |
| SMILES | [2H]C([2H])([2H])c1cc2c(oc3ccccc32)c(-c2ccc3cc([Si](C)(C)C)c(C)cc3[n+]2C)c1C |
| InChI | InChI=1S/C28H30NOSi/c1-17-14-22-21-10-8-9-11-25(21)30-28(22)27(19(17)3)23-13-12-20-16-26(31(5,6)7)18(2)15-24(20)29(23)4/h8-16H,1-7H3/q+1/i1D3 |
| InChIKey | SCEQKJBJVTYTGB-FIBGUPNXSA-N |
| XLogP | 6.70 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.66 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|