C19H17N2O+ — CID 140791369
3-methyl-4-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[3,2-c]pyridine (PubChem CID 140791369) has the molecular formula C19H17N2O+ and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-methyl-4-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[3,2-c]pyridine.
| Compound Name | 3-methyl-4-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 140791369 |
| Molecular Formula | C19H17N2O+ |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3-methyl-4-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[3,2-c]pyridine |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2c(C)ncc3c2oc2ccccc23)[n+](C)c1 |
| InChI | InChI=1S/C19H17N2O/c1-12-8-9-16(21(3)11-12)18-13(2)20-10-15-14-6-4-5-7-17(14)22-19(15)18/h4-11H,1-3H3/q+1/i1D3 |
| InChIKey | JSVNOAPNDDPOHC-FIBGUPNXSA-N |
| XLogP | 4.09 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|