C20H19N2O+ — CID 161248783
1,3-dimethyl-4-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-c]pyridine (PubChem CID 161248783) has the molecular formula C20H19N2O+ and a molecular weight of 306.40 g/mol. Its IUPAC name is 1,3-dimethyl-4-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-c]pyridine.
| Compound Name | 1,3-dimethyl-4-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-c]pyridine |
|---|---|
| PubChem CID | 161248783 |
| Molecular Formula | C20H19N2O+ |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1,3-dimethyl-4-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-c]pyridine |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2c(C)nc(C)c3oc4ccccc4c23)[n+](C)c1 |
| InChI | InChI=1S/C20H19N2O/c1-12-9-10-16(22(4)11-12)18-13(2)21-14(3)20-19(18)15-7-5-6-8-17(15)23-20/h5-11H,1-4H3/q+1/i1D3 |
| InChIKey | YASIPRWFFKFVLF-FIBGUPNXSA-N |
| XLogP | 4.40 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|