C40H41N2Si+ — CID 171459370
[9-[2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methylquinolin-1-ium-4-yl]carbazol-4-yl]-trimethylsilane (PubChem CID 171459370) has the molecular formula C40H41N2Si+ and a molecular weight of 577.87 g/mol. Its IUPAC name is [9-[2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methylquinolin-1-ium-4-yl]carbazol-4-yl]-trimethylsilane.
| Compound Name | [9-[2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methylquinolin-1-ium-4-yl]carbazol-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 171459370 |
| Molecular Formula | C40H41N2Si+ |
| Molecular Weight | 577.87 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | [9-[2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methylquinolin-1-ium-4-yl]carbazol-4-yl]-trimethylsilane |
| SMILES | Cc1c(-c2cc(-n3c4ccccc4c4c([Si](C)(C)C)cccc43)c3ccccc3[n+]2C)cc(C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C40H41N2Si/c1-26-27-16-9-10-17-28(27)32(40(2,3)4)24-31(26)36-25-37(29-18-11-13-20-33(29)41(36)5)42-34-21-14-12-19-30(34)39-35(42)22-15-23-38(39)43(6,7)8/h9-25H,1-8H3/q+1 |
| InChIKey | RSUMLJIXIXXWBH-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.87 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|