C30H28N3S2+ — CID 156665286
5-[2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methylquinolin-1-ium-4-yl]-2-methyl-[1,3]thiazolo[5,4-d][1,3]thiazole (PubChem CID 156665286) has the molecular formula C30H28N3S2+ and a molecular weight of 494.71 g/mol. Its IUPAC name is 5-[2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methylquinolin-1-ium-4-yl]-2-methyl-[1,3]thiazolo[5,4-d][1,3]thiazole.
| Compound Name | 5-[2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methylquinolin-1-ium-4-yl]-2-methyl-[1,3]thiazolo[5,4-d][1,3]thiazole |
|---|---|
| PubChem CID | 156665286 |
| Molecular Formula | C30H28N3S2+ |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 5-[2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methylquinolin-1-ium-4-yl]-2-methyl-[1,3]thiazolo[5,4-d][1,3]thiazole |
| SMILES | Cc1nc2sc(-c3cc(-c4cc(C(C)(C)C)c5ccccc5c4C)[n+](C)c4ccccc34)nc2s1 |
| InChI | InChI=1S/C30H28N3S2/c1-17-19-11-7-8-12-20(19)24(30(3,4)5)15-22(17)26-16-23(21-13-9-10-14-25(21)33(26)6)27-32-29-28(35-27)31-18(2)34-29/h7-16H,1-6H3/q+1 |
| InChIKey | BDJVMFVTBKVVMV-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|