C25H24NS2+ — CID 164756869
2-(4-tert-butyl-1-methylnaphthalen-2-yl)-3-methyl-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium (PubChem CID 164756869) has the molecular formula C25H24NS2+ and a molecular weight of 402.61 g/mol. Its IUPAC name is 2-(4-tert-butyl-1-methylnaphthalen-2-yl)-3-methyl-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium.
| Compound Name | 2-(4-tert-butyl-1-methylnaphthalen-2-yl)-3-methyl-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium |
|---|---|
| PubChem CID | 164756869 |
| Molecular Formula | C25H24NS2+ |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-(4-tert-butyl-1-methylnaphthalen-2-yl)-3-methyl-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium |
| SMILES | Cc1c(-c2sc3c4ccccc4sc3[n+]2C)cc(C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C25H24NS2/c1-15-16-10-6-7-11-17(16)20(25(2,3)4)14-19(15)23-26(5)24-22(28-23)18-12-8-9-13-21(18)27-24/h6-14H,1-5H3/q+1 |
| InChIKey | YIZSXXOOZFHRAD-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|