C28H34NSi+ — CID 166054514
[2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methylquinolin-1-ium-6-yl]-trimethylsilane (PubChem CID 166054514) has the molecular formula C28H34NSi+ and a molecular weight of 412.67 g/mol. Its IUPAC name is [2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methylquinolin-1-ium-6-yl]-trimethylsilane.
| Compound Name | [2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methylquinolin-1-ium-6-yl]-trimethylsilane |
|---|---|
| PubChem CID | 166054514 |
| Molecular Formula | C28H34NSi+ |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | [2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methylquinolin-1-ium-6-yl]-trimethylsilane |
| SMILES | Cc1c(-c2ccc3cc([Si](C)(C)C)ccc3[n+]2C)cc(C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C28H34NSi/c1-19-22-11-9-10-12-23(22)25(28(2,3)4)18-24(19)27-15-13-20-17-21(30(6,7)8)14-16-26(20)29(27)5/h9-18H,1-8H3/q+1 |
| InChIKey | FKOBWFSNEJBVSM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|