C31H24F8NS+ — CID 165383609
15-(4-tert-butyl-1-methylnaphthalen-2-yl)-3,3,4,4,5,5,6,6-octafluoro-14-methyl-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene (PubChem CID 165383609) has the molecular formula C31H24F8NS+ and a molecular weight of 594.59 g/mol. Its IUPAC name is 15-(4-tert-butyl-1-methylnaphthalen-2-yl)-3,3,4,4,5,5,6,6-octafluoro-14-methyl-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene.
| Compound Name | 15-(4-tert-butyl-1-methylnaphthalen-2-yl)-3,3,4,4,5,5,6,6-octafluoro-14-methyl-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 165383609 |
| Molecular Formula | C31H24F8NS+ |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | 15-(4-tert-butyl-1-methylnaphthalen-2-yl)-3,3,4,4,5,5,6,6-octafluoro-14-methyl-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene |
| SMILES | Cc1c(-c2c3sc4c5c(ccc4c3cc[n+]2C)C(F)(F)C(F)(F)C(F)(F)C5(F)F)cc(C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C31H24F8NS/c1-15-16-8-6-7-9-17(16)22(27(2,3)4)14-20(15)24-26-19(12-13-40(24)5)18-10-11-21-23(25(18)41-26)29(34,35)31(38,39)30(36,37)28(21,32)33/h6-14H,1-5H3/q+1 |
| InChIKey | IKYMGVDIFMYRNA-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|