C22H21N4S+ — CID 164783213
7-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-isocyano-6-methyl-[1,3]thiazolo[4,5-d]pyrimidin-6-ium (PubChem CID 164783213) has the molecular formula C22H21N4S+ and a molecular weight of 373.51 g/mol. Its IUPAC name is 7-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-isocyano-6-methyl-[1,3]thiazolo[4,5-d]pyrimidin-6-ium.
| Compound Name | 7-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-isocyano-6-methyl-[1,3]thiazolo[4,5-d]pyrimidin-6-ium |
|---|---|
| PubChem CID | 164783213 |
| Molecular Formula | C22H21N4S+ |
| Molecular Weight | 373.51 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 7-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-isocyano-6-methyl-[1,3]thiazolo[4,5-d]pyrimidin-6-ium |
| SMILES | [C-]#[N+]c1nc2nc[n+](C)c(-c3cc(C(C)(C)C)c4ccccc4c3C)c2s1 |
| InChI | InChI=1S/C22H21N4S/c1-13-14-9-7-8-10-15(14)17(22(2,3)4)11-16(13)18-19-20(24-12-26(18)6)25-21(23-5)27-19/h7-12H,1-4,6H3/q+1 |
| InChIKey | DNVCJVPJBWYITO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 34.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|