C24H21F6N4+ — CID 170395542
4-(4-tert-butyl-1-methylnaphthalen-2-yl)-3-methyl-6,7-bis(trifluoromethyl)pteridin-3-ium (PubChem CID 170395542) has the molecular formula C24H21F6N4+ and a molecular weight of 479.45 g/mol. Its IUPAC name is 4-(4-tert-butyl-1-methylnaphthalen-2-yl)-3-methyl-6,7-bis(trifluoromethyl)pteridin-3-ium.
| Compound Name | 4-(4-tert-butyl-1-methylnaphthalen-2-yl)-3-methyl-6,7-bis(trifluoromethyl)pteridin-3-ium |
|---|---|
| PubChem CID | 170395542 |
| Molecular Formula | C24H21F6N4+ |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 4-(4-tert-butyl-1-methylnaphthalen-2-yl)-3-methyl-6,7-bis(trifluoromethyl)pteridin-3-ium |
| SMILES | Cc1c(-c2c3nc(C(F)(F)F)c(C(F)(F)F)nc3nc[n+]2C)cc(C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C24H21F6N4/c1-12-13-8-6-7-9-14(13)16(22(2,3)4)10-15(12)18-17-21(31-11-34(18)5)33-20(24(28,29)30)19(32-17)23(25,26)27/h6-11H,1-5H3/q+1 |
| InChIKey | VMGYAFCIPZDCSR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 42.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|