C29H26N3+ — CID 164783350
4-(4-tert-butyl-1-methylnaphthalen-2-yl)-7-isocyano-3-methylbenzo[h]quinazolin-3-ium (PubChem CID 164783350) has the molecular formula C29H26N3+ and a molecular weight of 416.55 g/mol. Its IUPAC name is 4-(4-tert-butyl-1-methylnaphthalen-2-yl)-7-isocyano-3-methylbenzo[h]quinazolin-3-ium.
| Compound Name | 4-(4-tert-butyl-1-methylnaphthalen-2-yl)-7-isocyano-3-methylbenzo[h]quinazolin-3-ium |
|---|---|
| PubChem CID | 164783350 |
| Molecular Formula | C29H26N3+ |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 4-(4-tert-butyl-1-methylnaphthalen-2-yl)-7-isocyano-3-methylbenzo[h]quinazolin-3-ium |
| SMILES | [C-]#[N+]c1cccc2c1ccc1c(-c3cc(C(C)(C)C)c4ccccc4c3C)[n+](C)cnc12 |
| InChI | InChI=1S/C29H26N3/c1-18-19-10-7-8-11-20(19)25(29(2,3)4)16-24(18)28-23-15-14-21-22(12-9-13-26(21)30-5)27(23)31-17-32(28)6/h7-17H,1-4,6H3/q+1 |
| InChIKey | KADPTRPEUINPKG-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 21.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|