C26H26NS+ — CID 164757015
2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methyl-3H-[1]benzothiolo[3,2-b]pyrrol-1-ium (PubChem CID 164757015) has the molecular formula C26H26NS+ and a molecular weight of 384.57 g/mol. Its IUPAC name is 2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methyl-3H-[1]benzothiolo[3,2-b]pyrrol-1-ium.
| Compound Name | 2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methyl-3H-[1]benzothiolo[3,2-b]pyrrol-1-ium |
|---|---|
| PubChem CID | 164757015 |
| Molecular Formula | C26H26NS+ |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-(4-tert-butyl-1-methylnaphthalen-2-yl)-1-methyl-3H-[1]benzothiolo[3,2-b]pyrrol-1-ium |
| SMILES | Cc1c(C2=[N+](C)c3c(sc4ccccc34)C2)cc(C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C26H26NS/c1-16-17-10-6-7-11-18(17)21(26(2,3)4)14-20(16)22-15-24-25(27(22)5)19-12-8-9-13-23(19)28-24/h6-14H,15H2,1-5H3/q+1 |
| InChIKey | YBZASYRGTWVKTC-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|