C25H18F8NS+ — CID 165383689
3,3,4,4,5,5,6,6-octafluoro-14-methyl-15-(2,3,5-trimethylphenyl)-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene (PubChem CID 165383689) has the molecular formula C25H18F8NS+ and a molecular weight of 516.48 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6-octafluoro-14-methyl-15-(2,3,5-trimethylphenyl)-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene.
| Compound Name | 3,3,4,4,5,5,6,6-octafluoro-14-methyl-15-(2,3,5-trimethylphenyl)-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 165383689 |
| Molecular Formula | C25H18F8NS+ |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 3,3,4,4,5,5,6,6-octafluoro-14-methyl-15-(2,3,5-trimethylphenyl)-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene |
| SMILES | Cc1cc(C)c(C)c(-c2c3sc4c5c(ccc4c3cc[n+]2C)C(F)(F)C(F)(F)C(F)(F)C5(F)F)c1 |
| InChI | InChI=1S/C25H18F8NS/c1-11-9-12(2)13(3)16(10-11)19-21-15(7-8-34(19)4)14-5-6-17-18(20(14)35-21)23(28,29)25(32,33)24(30,31)22(17,26)27/h5-10H,1-4H3/q+1 |
| InChIKey | FLUUCWFDYIKHON-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|