C23H13F8NS — CID 165383784
15-(3,5-dimethylphenyl)-3,3,4,4,5,5,6,6-octafluoro-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene (PubChem CID 165383784) has the molecular formula C23H13F8NS and a molecular weight of 487.42 g/mol. Its IUPAC name is 15-(3,5-dimethylphenyl)-3,3,4,4,5,5,6,6-octafluoro-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene.
| Compound Name | 15-(3,5-dimethylphenyl)-3,3,4,4,5,5,6,6-octafluoro-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 165383784 |
| Molecular Formula | C23H13F8NS |
| Molecular Weight | 487.42 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 15-(3,5-dimethylphenyl)-3,3,4,4,5,5,6,6-octafluoro-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene |
| SMILES | Cc1cc(C)cc(-c2nccc3c2sc2c4c(ccc23)C(F)(F)C(F)(F)C(F)(F)C4(F)F)c1 |
| InChI | InChI=1S/C23H13F8NS/c1-10-7-11(2)9-12(8-10)17-19-14(5-6-32-17)13-3-4-15-16(18(13)33-19)21(26,27)23(30,31)22(28,29)20(15,24)25/h3-9H,1-2H3 |
| InChIKey | KDJPTMHPFGMTRF-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.42 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|