C22H22N2S — CID 153428523
6-(3,5-dimethylphenyl)-10-(2-methylpropyl)-8-thia-5,11-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 153428523) has the molecular formula C22H22N2S and a molecular weight of 346.50 g/mol. Its IUPAC name is 6-(3,5-dimethylphenyl)-10-(2-methylpropyl)-8-thia-5,11-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-(3,5-dimethylphenyl)-10-(2-methylpropyl)-8-thia-5,11-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 153428523 |
| Molecular Formula | C22H22N2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 6-(3,5-dimethylphenyl)-10-(2-methylpropyl)-8-thia-5,11-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1cc(C)cc(-c2nccc3c2sc2c(CC(C)C)nccc23)c1 |
| InChI | InChI=1S/C22H22N2S/c1-13(2)9-19-21-17(5-7-23-19)18-6-8-24-20(22(18)25-21)16-11-14(3)10-15(4)12-16/h5-8,10-13H,9H2,1-4H3 |
| InChIKey | IFMXGWIKDNLZBN-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |