C20H22N2 — CID 140872725
2-(3,5-dimethylphenyl)-3-(2-methylpropyl)quinoxaline (PubChem CID 140872725) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-3-(2-methylpropyl)quinoxaline.
| Compound Name | 2-(3,5-dimethylphenyl)-3-(2-methylpropyl)quinoxaline |
|---|---|
| PubChem CID | 140872725 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-3-(2-methylpropyl)quinoxaline |
| SMILES | Cc1cc(C)cc(-c2nc3ccccc3nc2CC(C)C)c1 |
| InChI | InChI=1S/C20H22N2/c1-13(2)9-19-20(16-11-14(3)10-15(4)12-16)22-18-8-6-5-7-17(18)21-19/h5-8,10-13H,9H2,1-4H3 |
| InChIKey | ZWPYMQLIBXMFQS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |