C20H22N2 — CID 141430614
6,7-dimethyl-2-(2-methylpropyl)-3-phenylquinoxaline (PubChem CID 141430614) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 6,7-dimethyl-2-(2-methylpropyl)-3-phenylquinoxaline.
| Compound Name | 6,7-dimethyl-2-(2-methylpropyl)-3-phenylquinoxaline |
|---|---|
| PubChem CID | 141430614 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 6,7-dimethyl-2-(2-methylpropyl)-3-phenylquinoxaline |
| SMILES | Cc1cc2nc(CC(C)C)c(-c3ccccc3)nc2cc1C |
| InChI | InChI=1S/C20H22N2/c1-13(2)10-19-20(16-8-6-5-7-9-16)22-18-12-15(4)14(3)11-17(18)21-19/h5-9,11-13H,10H2,1-4H3 |
| InChIKey | FRGLEPOQTJBLMA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |