C54H42N6 — CID 18504282
2-[3,5-bis(6,7-dimethyl-3-phenylquinoxalin-2-yl)phenyl]-6,7-dimethyl-3-phenylquinoxaline (PubChem CID 18504282) has the molecular formula C54H42N6 and a molecular weight of 774.97 g/mol. Its IUPAC name is 2-[3,5-bis(6,7-dimethyl-3-phenylquinoxalin-2-yl)phenyl]-6,7-dimethyl-3-phenylquinoxaline.
| Compound Name | 2-[3,5-bis(6,7-dimethyl-3-phenylquinoxalin-2-yl)phenyl]-6,7-dimethyl-3-phenylquinoxaline |
|---|---|
| PubChem CID | 18504282 |
| Molecular Formula | C54H42N6 |
| Molecular Weight | 774.97 g/mol |
| Exact Mass | 774.35 |
| IUPAC Name | 2-[3,5-bis(6,7-dimethyl-3-phenylquinoxalin-2-yl)phenyl]-6,7-dimethyl-3-phenylquinoxaline |
| SMILES | Cc1cc2nc(-c3ccccc3)c(-c3cc(-c4nc5cc(C)c(C)cc5nc4-c4ccccc4)cc(-c4nc5cc(C)c(C)cc5nc4-c4ccccc4)c3)nc2cc1C |
| InChI | InChI=1S/C54H42N6/c1-31-22-43-46(25-34(31)4)58-52(49(55-43)37-16-10-7-11-17-37)40-28-41(53-50(38-18-12-8-13-19-38)56-44-23-32(2)35(5)26-47(44)59-53)30-42(29-40)54-51(39-20-14-9-15-21-39)57-45-24-33(3)36(6)27-48(45)60-54/h7-30H,1-6H3 |
| InChIKey | HIWIQJLLQLAWMM-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.97 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |