About 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline
6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline (PubChem CID 71729476) has the molecular formula C22H15F3N2
and a molecular weight of 364.37 g/mol. Its IUPAC name is 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline.
Molecular Properties
| Compound Name | 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline |
| PubChem CID | 71729476 |
| Molecular Formula | C22H15F3N2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline |
| SMILES | Cc1cc2nc(-c3ccccc3)c(-c3c(F)cc(F)cc3F)nc2cc1C |
| InChI | InChI=1S/C22H15F3N2/c1-12-8-18-19(9-13(12)2)27-22(20-16(24)10-15(23)11-17(20)25)21(26-18)14-6-4-3-5-7-14/h3-11H,1-2H3 |
| InChIKey | ITRDVUOGKJZMFC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline?
The IUPAC name of 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline (CID 71729476) is 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline.
What is the SMILES notation for 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline?
The canonical SMILES for 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline is Cc1cc2nc(-c3ccccc3)c(-c3c(F)cc(F)cc3F)nc2cc1C.
What is the InChIKey of 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline?
The InChIKey is ITRDVUOGKJZMFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F3N2/c1-12-8-18-19(9-13(12)2)27-22(20-16(24)10-15(23)11-17(20)25)21(26-18)14-6-4-3-5-7-14/h3-11H,1-2H3.
What are the key properties of 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline?
6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline has a molecular weight of 364.37 g/mol, XLogP of 6.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline is sourced from PubChem (CID 71729476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).