C22H15F3N2 — CID 71729476
6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline (PubChem CID 71729476) has the molecular formula C22H15F3N2 and a molecular weight of 364.37 g/mol. Its IUPAC name is 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline.
| Compound Name | 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline |
|---|---|
| PubChem CID | 71729476 |
| Molecular Formula | C22H15F3N2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 6,7-dimethyl-2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline |
| SMILES | Cc1cc2nc(-c3ccccc3)c(-c3c(F)cc(F)cc3F)nc2cc1C |
| InChI | InChI=1S/C22H15F3N2/c1-12-8-18-19(9-13(12)2)27-22(20-16(24)10-15(23)11-17(20)25)21(26-18)14-6-4-3-5-7-14/h3-11H,1-2H3 |
| InChIKey | ITRDVUOGKJZMFC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |