C21H22FN — CID 155627713
2-(3,5-dimethylphenyl)-6-fluoro-4-(2-methylpropyl)quinoline (PubChem CID 155627713) has the molecular formula C21H22FN and a molecular weight of 307.41 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-6-fluoro-4-(2-methylpropyl)quinoline.
| Compound Name | 2-(3,5-dimethylphenyl)-6-fluoro-4-(2-methylpropyl)quinoline |
|---|---|
| PubChem CID | 155627713 |
| Molecular Formula | C21H22FN |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-6-fluoro-4-(2-methylpropyl)quinoline |
| SMILES | Cc1cc(C)cc(-c2cc(CC(C)C)c3cc(F)ccc3n2)c1 |
| InChI | InChI=1S/C21H22FN/c1-13(2)7-16-11-21(17-9-14(3)8-15(4)10-17)23-20-6-5-18(22)12-19(16)20/h5-6,8-13H,7H2,1-4H3 |
| InChIKey | QLPXCJZYQAVBGA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |