C20H18F3N — CID 121266831
2-(3,5-dimethylphenyl)-5-(3,3,3-trifluoropropyl)quinoline (PubChem CID 121266831) has the molecular formula C20H18F3N and a molecular weight of 329.37 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-5-(3,3,3-trifluoropropyl)quinoline.
| Compound Name | 2-(3,5-dimethylphenyl)-5-(3,3,3-trifluoropropyl)quinoline |
|---|---|
| PubChem CID | 121266831 |
| Molecular Formula | C20H18F3N |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-5-(3,3,3-trifluoropropyl)quinoline |
| SMILES | Cc1cc(C)cc(-c2ccc3c(CCC(F)(F)F)cccc3n2)c1 |
| InChI | InChI=1S/C20H18F3N/c1-13-10-14(2)12-16(11-13)18-7-6-17-15(8-9-20(21,22)23)4-3-5-19(17)24-18/h3-7,10-12H,8-9H2,1-2H3 |
| InChIKey | KLIHTMCAQNIGFE-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |