C21H20F3N — CID 130343625
4-(3,3,3-trifluoropropyl)-2-(2,3,5-trimethylphenyl)quinoline (PubChem CID 130343625) has the molecular formula C21H20F3N and a molecular weight of 343.39 g/mol. Its IUPAC name is 4-(3,3,3-trifluoropropyl)-2-(2,3,5-trimethylphenyl)quinoline.
| Compound Name | 4-(3,3,3-trifluoropropyl)-2-(2,3,5-trimethylphenyl)quinoline |
|---|---|
| PubChem CID | 130343625 |
| Molecular Formula | C21H20F3N |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 4-(3,3,3-trifluoropropyl)-2-(2,3,5-trimethylphenyl)quinoline |
| SMILES | Cc1cc(C)c(C)c(-c2cc(CCC(F)(F)F)c3ccccc3n2)c1 |
| InChI | InChI=1S/C21H20F3N/c1-13-10-14(2)15(3)18(11-13)20-12-16(8-9-21(22,23)24)17-6-4-5-7-19(17)25-20/h4-7,10-12H,8-9H2,1-3H3 |
| InChIKey | HBRSXASECZQBBC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |