C20H21N — CID 59348556
4-methyl-2-(2,3,4,5-tetramethylphenyl)quinoline (PubChem CID 59348556) has the molecular formula C20H21N and a molecular weight of 275.39 g/mol. Its IUPAC name is 4-methyl-2-(2,3,4,5-tetramethylphenyl)quinoline.
| Compound Name | 4-methyl-2-(2,3,4,5-tetramethylphenyl)quinoline |
|---|---|
| PubChem CID | 59348556 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 4-methyl-2-(2,3,4,5-tetramethylphenyl)quinoline |
| SMILES | Cc1cc(-c2cc(C)c3ccccc3n2)c(C)c(C)c1C |
| InChI | InChI=1S/C20H21N/c1-12-10-18(16(5)15(4)14(12)3)20-11-13(2)17-8-6-7-9-19(17)21-20/h6-11H,1-5H3 |
| InChIKey | AEPROKIEIDVCFK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |