C18H18ClN — CID 47104793
2-(3,4-dimethylphenyl)-4-methylquinoline;hydrochloride (PubChem CID 47104793) has the molecular formula C18H18ClN and a molecular weight of 283.80 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-4-methylquinoline;hydrochloride.
| Compound Name | 2-(3,4-dimethylphenyl)-4-methylquinoline;hydrochloride |
|---|---|
| PubChem CID | 47104793 |
| Molecular Formula | C18H18ClN |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-4-methylquinoline;hydrochloride |
| SMILES | Cc1ccc(-c2cc(C)c3ccccc3n2)cc1C.Cl |
| InChI | InChI=1S/C18H17N.ClH/c1-12-8-9-15(10-13(12)2)18-11-14(3)16-6-4-5-7-17(16)19-18;/h4-11H,1-3H3;1H |
| InChIKey | IISLSMXNBWBIRM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |