C12H8BrN3S — CID 102617864
5-bromo-3-(4-methylquinolin-2-yl)-1,2,4-thiadiazole (PubChem CID 102617864) has the molecular formula C12H8BrN3S and a molecular weight of 306.19 g/mol. Its IUPAC name is 5-bromo-3-(4-methylquinolin-2-yl)-1,2,4-thiadiazole.
| Compound Name | 5-bromo-3-(4-methylquinolin-2-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102617864 |
| Molecular Formula | C12H8BrN3S |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 5-bromo-3-(4-methylquinolin-2-yl)-1,2,4-thiadiazole |
| SMILES | Cc1cc(-c2nsc(Br)n2)nc2ccccc12 |
| InChI | InChI=1S/C12H8BrN3S/c1-7-6-10(11-15-12(13)17-16-11)14-9-5-3-2-4-8(7)9/h2-6H,1H3 |
| InChIKey | ILYDYVPIPWYGBQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |