C28H29NSSi — CID 170932025
trimethyl-[3-[8-(2-methylpropyl)-[1]benzothiolo[2,3-c]pyridin-1-yl]naphthalen-1-yl]silane (PubChem CID 170932025) has the molecular formula C28H29NSSi and a molecular weight of 439.70 g/mol. Its IUPAC name is trimethyl-[3-[8-(2-methylpropyl)-[1]benzothiolo[2,3-c]pyridin-1-yl]naphthalen-1-yl]silane.
| Compound Name | trimethyl-[3-[8-(2-methylpropyl)-[1]benzothiolo[2,3-c]pyridin-1-yl]naphthalen-1-yl]silane |
|---|---|
| PubChem CID | 170932025 |
| Molecular Formula | C28H29NSSi |
| Molecular Weight | 439.70 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | trimethyl-[3-[8-(2-methylpropyl)-[1]benzothiolo[2,3-c]pyridin-1-yl]naphthalen-1-yl]silane |
| SMILES | CC(C)Cc1cccc2c1sc1c(-c3cc([Si](C)(C)C)c4ccccc4c3)nccc12 |
| InChI | InChI=1S/C28H29NSSi/c1-18(2)15-20-10-8-12-23-24-13-14-29-26(28(24)30-27(20)23)21-16-19-9-6-7-11-22(19)25(17-21)31(3,4)5/h6-14,16-18H,15H2,1-5H3 |
| InChIKey | MEJXIRPWBCXWOC-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.70 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|