C28H27F2NSSi — CID 170533908
[difluoro-[1-(4-propan-2-ylnaphthalen-2-yl)-[1]benzothiolo[2,3-c]pyridin-8-yl]methyl]-trimethylsilane (PubChem CID 170533908) has the molecular formula C28H27F2NSSi and a molecular weight of 475.68 g/mol. Its IUPAC name is [difluoro-[1-(4-propan-2-ylnaphthalen-2-yl)-[1]benzothiolo[2,3-c]pyridin-8-yl]methyl]-trimethylsilane.
| Compound Name | [difluoro-[1-(4-propan-2-ylnaphthalen-2-yl)-[1]benzothiolo[2,3-c]pyridin-8-yl]methyl]-trimethylsilane |
|---|---|
| PubChem CID | 170533908 |
| Molecular Formula | C28H27F2NSSi |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | [difluoro-[1-(4-propan-2-ylnaphthalen-2-yl)-[1]benzothiolo[2,3-c]pyridin-8-yl]methyl]-trimethylsilane |
| SMILES | CC(C)c1cc(-c2nccc3c2sc2c(C(F)(F)[Si](C)(C)C)cccc23)cc2ccccc12 |
| InChI | InChI=1S/C28H27F2NSSi/c1-17(2)23-16-19(15-18-9-6-7-10-20(18)23)25-27-22(13-14-31-25)21-11-8-12-24(26(21)32-27)28(29,30)33(3,4)5/h6-17H,1-5H3 |
| InChIKey | VQCWFOMQEPDQSZ-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|