C28H29NSSi — CID 170533921
trimethyl-[7-methyl-1-(4-propan-2-ylnaphthalen-2-yl)-[1]benzothiolo[2,3-c]pyridin-8-yl]silane (PubChem CID 170533921) has the molecular formula C28H29NSSi and a molecular weight of 439.70 g/mol. Its IUPAC name is trimethyl-[7-methyl-1-(4-propan-2-ylnaphthalen-2-yl)-[1]benzothiolo[2,3-c]pyridin-8-yl]silane.
| Compound Name | trimethyl-[7-methyl-1-(4-propan-2-ylnaphthalen-2-yl)-[1]benzothiolo[2,3-c]pyridin-8-yl]silane |
|---|---|
| PubChem CID | 170533921 |
| Molecular Formula | C28H29NSSi |
| Molecular Weight | 439.70 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | trimethyl-[7-methyl-1-(4-propan-2-ylnaphthalen-2-yl)-[1]benzothiolo[2,3-c]pyridin-8-yl]silane |
| SMILES | Cc1ccc2c(sc3c(-c4cc(C(C)C)c5ccccc5c4)nccc32)c1[Si](C)(C)C |
| InChI | InChI=1S/C28H29NSSi/c1-17(2)24-16-20(15-19-9-7-8-10-21(19)24)25-26-23(13-14-29-25)22-12-11-18(3)28(27(22)30-26)31(4,5)6/h7-17H,1-6H3 |
| InChIKey | ABKYRJDUNXFMLH-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.70 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|