C32H36SSi — CID 170932126
triethyl-[3-[6-(2-methylpropyl)dibenzothiophen-4-yl]naphthalen-1-yl]silane (PubChem CID 170932126) has the molecular formula C32H36SSi and a molecular weight of 480.79 g/mol. Its IUPAC name is triethyl-[3-[6-(2-methylpropyl)dibenzothiophen-4-yl]naphthalen-1-yl]silane.
| Compound Name | triethyl-[3-[6-(2-methylpropyl)dibenzothiophen-4-yl]naphthalen-1-yl]silane |
|---|---|
| PubChem CID | 170932126 |
| Molecular Formula | C32H36SSi |
| Molecular Weight | 480.79 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | triethyl-[3-[6-(2-methylpropyl)dibenzothiophen-4-yl]naphthalen-1-yl]silane |
| SMILES | CC[Si](CC)(CC)c1cc(-c2cccc3c2sc2c(CC(C)C)cccc23)cc2ccccc12 |
| InChI | InChI=1S/C32H36SSi/c1-6-34(7-2,8-3)30-21-25(20-23-13-9-10-15-26(23)30)27-16-12-18-29-28-17-11-14-24(19-22(4)5)31(28)33-32(27)29/h9-18,20-22H,6-8,19H2,1-5H3 |
| InChIKey | WYZQODSNPSMCSI-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.79 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|