C28H28F2N2SSi — CID 176623417
[3-[7-(2,2-difluoroethyl)-[1]benzothiolo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]-triethylsilane (PubChem CID 176623417) has the molecular formula C28H28F2N2SSi and a molecular weight of 490.70 g/mol. Its IUPAC name is [3-[7-(2,2-difluoroethyl)-[1]benzothiolo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]-triethylsilane.
| Compound Name | [3-[7-(2,2-difluoroethyl)-[1]benzothiolo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]-triethylsilane |
|---|---|
| PubChem CID | 176623417 |
| Molecular Formula | C28H28F2N2SSi |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | [3-[7-(2,2-difluoroethyl)-[1]benzothiolo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]-triethylsilane |
| SMILES | CC[Si](CC)(CC)c1cc(-c2ncnc3c2sc2cc(CC(F)F)ccc23)cc2ccccc12 |
| InChI | InChI=1S/C28H28F2N2SSi/c1-4-34(5-2,6-3)24-16-20(15-19-9-7-8-10-21(19)24)26-28-27(32-17-31-26)22-12-11-18(14-25(29)30)13-23(22)33-28/h7-13,15-17,25H,4-6,14H2,1-3H3 |
| InChIKey | MWUMFAZCODJYKW-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|