C34H42N2SSi — CID 176855199
[3-[7-(2,2-dimethylpropyl)-[1]benzothiolo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]-tri(propan-2-yl)silane (PubChem CID 176855199) has the molecular formula C34H42N2SSi and a molecular weight of 538.88 g/mol. Its IUPAC name is [3-[7-(2,2-dimethylpropyl)-[1]benzothiolo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]-tri(propan-2-yl)silane.
| Compound Name | [3-[7-(2,2-dimethylpropyl)-[1]benzothiolo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 176855199 |
| Molecular Formula | C34H42N2SSi |
| Molecular Weight | 538.88 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | [3-[7-(2,2-dimethylpropyl)-[1]benzothiolo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](c1cc(-c2ncnc3c2sc2cc(CC(C)(C)C)ccc23)cc2ccccc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H42N2SSi/c1-21(2)38(22(3)4,23(5)6)30-18-26(17-25-12-10-11-13-27(25)30)31-33-32(36-20-35-31)28-15-14-24(16-29(28)37-33)19-34(7,8)9/h10-18,20-23H,19H2,1-9H3 |
| InChIKey | NLBMUNCISSQQAT-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.88 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|