C32H36N2SSi — CID 176855323
[3-[7-(cyclopentylmethyl)-[1]benzothiolo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]-triethylsilane (PubChem CID 176855323) has the molecular formula C32H36N2SSi and a molecular weight of 508.81 g/mol. Its IUPAC name is [3-[7-(cyclopentylmethyl)-[1]benzothiolo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]-triethylsilane.
| Compound Name | [3-[7-(cyclopentylmethyl)-[1]benzothiolo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]-triethylsilane |
|---|---|
| PubChem CID | 176855323 |
| Molecular Formula | C32H36N2SSi |
| Molecular Weight | 508.81 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | [3-[7-(cyclopentylmethyl)-[1]benzothiolo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]-triethylsilane |
| SMILES | CC[Si](CC)(CC)c1cc(-c2ncnc3c2sc2cc(CC4CCCC4)ccc23)cc2ccccc12 |
| InChI | InChI=1S/C32H36N2SSi/c1-4-36(5-2,6-3)29-20-25(19-24-13-9-10-14-26(24)29)30-32-31(34-21-33-30)27-16-15-23(18-28(27)35-32)17-22-11-7-8-12-22/h9-10,13-16,18-22H,4-8,11-12,17H2,1-3H3 |
| InChIKey | DFULAFKTNUPQCE-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.81 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|