C28H30N2SSi — CID 176855201
[6-(7-tert-butyl-[1]benzothiolo[3,2-d]pyrimidin-4-yl)-8-methylnaphthalen-2-yl]-trimethylsilane (PubChem CID 176855201) has the molecular formula C28H30N2SSi and a molecular weight of 454.72 g/mol. Its IUPAC name is [6-(7-tert-butyl-[1]benzothiolo[3,2-d]pyrimidin-4-yl)-8-methylnaphthalen-2-yl]-trimethylsilane.
| Compound Name | [6-(7-tert-butyl-[1]benzothiolo[3,2-d]pyrimidin-4-yl)-8-methylnaphthalen-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 176855201 |
| Molecular Formula | C28H30N2SSi |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | [6-(7-tert-butyl-[1]benzothiolo[3,2-d]pyrimidin-4-yl)-8-methylnaphthalen-2-yl]-trimethylsilane |
| SMILES | Cc1cc(-c2ncnc3c2sc2cc(C(C)(C)C)ccc23)cc2ccc([Si](C)(C)C)cc12 |
| InChI | InChI=1S/C28H30N2SSi/c1-17-12-19(13-18-8-10-21(15-23(17)18)32(5,6)7)25-27-26(30-16-29-25)22-11-9-20(28(2,3)4)14-24(22)31-27/h8-16H,1-7H3 |
| InChIKey | ZANZEWOPDYSUJG-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|