C18H20S — CID 167531835
7-tert-butyl-3,4-dimethyldibenzothiophene (PubChem CID 167531835) has the molecular formula C18H20S and a molecular weight of 268.43 g/mol. Its IUPAC name is 7-tert-butyl-3,4-dimethyldibenzothiophene.
| Compound Name | 7-tert-butyl-3,4-dimethyldibenzothiophene |
|---|---|
| PubChem CID | 167531835 |
| Molecular Formula | C18H20S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 7-tert-butyl-3,4-dimethyldibenzothiophene |
| SMILES | Cc1ccc2c(sc3cc(C(C)(C)C)ccc32)c1C |
| InChI | InChI=1S/C18H20S/c1-11-6-8-15-14-9-7-13(18(3,4)5)10-16(14)19-17(15)12(11)2/h6-10H,1-5H3 |
| InChIKey | DEUSALIIPBKPIU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |