C14H11FS — CID 146657158
4-fluoro-3,7-dimethyldibenzothiophene (PubChem CID 146657158) has the molecular formula C14H11FS and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-fluoro-3,7-dimethyldibenzothiophene.
| Compound Name | 4-fluoro-3,7-dimethyldibenzothiophene |
|---|---|
| PubChem CID | 146657158 |
| Molecular Formula | C14H11FS |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-fluoro-3,7-dimethyldibenzothiophene |
| SMILES | Cc1ccc2c(c1)sc1c(F)c(C)ccc12 |
| InChI | InChI=1S/C14H11FS/c1-8-3-5-10-11-6-4-9(2)13(15)14(11)16-12(10)7-8/h3-7H,1-2H3 |
| InChIKey | GIXTYDGXNWNKSS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |