C9H6F2S — CID 129075425
2,3-difluoro-6-methyl-1-benzothiophene (PubChem CID 129075425) has the molecular formula C9H6F2S and a molecular weight of 184.21 g/mol. Its IUPAC name is 2,3-difluoro-6-methyl-1-benzothiophene.
| Compound Name | 2,3-difluoro-6-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 129075425 |
| Molecular Formula | C9H6F2S |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 2,3-difluoro-6-methyl-1-benzothiophene |
| SMILES | Cc1ccc2c(F)c(F)sc2c1 |
| InChI | InChI=1S/C9H6F2S/c1-5-2-3-6-7(4-5)12-9(11)8(6)10/h2-4H,1H3 |
| InChIKey | UTVVPTXWCRITSE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |