About 7-methyl-1,2-dimethylidene-[1]benzothiolo[5,6-b][1]benzothiole
7-methyl-1,2-dimethylidene-[1]benzothiolo[5,6-b][1]benzothiole (PubChem CID 146520517) has the molecular formula C17H12S2
and a molecular weight of 280.42 g/mol. Its IUPAC name is 7-methyl-1,2-dimethylidene-[1]benzothiolo[5,6-b][1]benzothiole.
Molecular Properties
| Compound Name | 7-methyl-1,2-dimethylidene-[1]benzothiolo[5,6-b][1]benzothiole |
| PubChem CID | 146520517 |
| Molecular Formula | C17H12S2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 7-methyl-1,2-dimethylidene-[1]benzothiolo[5,6-b][1]benzothiole |
| SMILES | C=c1sc2cc3c(cc2c1=C)sc1cc(C)ccc13 |
| InChI | InChI=1S/C17H12S2/c1-9-4-5-12-14-8-16-13(10(2)11(3)18-16)7-17(14)19-15(12)6-9/h4-8H,2-3H2,1H3 |
| InChIKey | PTTBRNABGMOQOG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-1,2-dimethylidene-[1]benzothiolo[5,6-b][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1,2-dimethylidene-[1]benzothiolo[5,6-b][1]benzothiole?
The IUPAC name of 7-methyl-1,2-dimethylidene-[1]benzothiolo[5,6-b][1]benzothiole (CID 146520517) is 7-methyl-1,2-dimethylidene-[1]benzothiolo[5,6-b][1]benzothiole.
What is the SMILES notation for 7-methyl-1,2-dimethylidene-[1]benzothiolo[5,6-b][1]benzothiole?
The canonical SMILES for 7-methyl-1,2-dimethylidene-[1]benzothiolo[5,6-b][1]benzothiole is C=c1sc2cc3c(cc2c1=C)sc1cc(C)ccc13.
What is the InChIKey of 7-methyl-1,2-dimethylidene-[1]benzothiolo[5,6-b][1]benzothiole?
The InChIKey is PTTBRNABGMOQOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12S2/c1-9-4-5-12-14-8-16-13(10(2)11(3)18-16)7-17(14)19-15(12)6-9/h4-8H,2-3H2,1H3.
What are the key properties of 7-methyl-1,2-dimethylidene-[1]benzothiolo[5,6-b][1]benzothiole?
7-methyl-1,2-dimethylidene-[1]benzothiolo[5,6-b][1]benzothiole has a molecular weight of 280.42 g/mol, XLogP of 4.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1,2-dimethylidene-[1]benzothiolo[5,6-b][1]benzothiole is sourced from PubChem (CID 146520517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).